EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15NO5 |
| Net Charge | 0 |
| Average Mass | 277.276 |
| Monoisotopic Mass | 277.09502 |
| SMILES | CC1(C)Oc2ccc3c(C(=O)O)cnc3c2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H15NO5/c1-14(2)12(17)11(16)9-8(20-14)4-3-6-7(13(18)19)5-15-10(6)9/h3-5,11-12,15-17H,1-2H3,(H,18,19)/t11-,12+/m0/s1 |
| InChIKey | LGDYFFQYPZQWFT-NWDGAFQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nigrospora (ncbitaxon:114230) | - | DOI (10.1016/j.tetlet.2014.03.060) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nigrospin A (CHEBI:213305) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (8R,9S)-8,9-dihydroxy-7,7-dimethyl-8,9-dihydro-1H-pyrano[2,3-g]indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 32675108 | ChemSpider |