EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O5 |
| Net Charge | 0 |
| Average Mass | 326.348 |
| Monoisotopic Mass | 326.11542 |
| SMILES | COc1cccc2c1-c1c(O)cc3c(c1C2=O)[C@@H](O)C[C@H](C)[C@@H]3O |
| InChI | InChI=1S/C19H18O5/c1-8-6-11(20)14-10(18(8)22)7-12(21)16-15-9(19(23)17(14)16)4-3-5-13(15)24-2/h3-5,7-8,11,18,20-22H,6H2,1-2H3/t8-,11-,18-/m0/s1 |
| InChIKey | FNCSWMAZTOJBIF-XYVASLDOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (29522466) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluostatin O (CHEBI:213299) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (1S,3S,4S)-1,4,6-trihydroxy-7-methoxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]luoren-11-one |
| Manual Xrefs | Databases |
|---|---|
| 65321335 | ChemSpider |