EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O2 |
| Net Charge | 0 |
| Average Mass | 398.631 |
| Monoisotopic Mass | 398.31848 |
| SMILES | C=C(CC/C=C1\CC[C@H]2C3=CC[C@H]4C[C@@H](O)C[C@@H](O)[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C27H42O2/c1-17(2)18(3)7-6-8-19-10-12-23-22-11-9-20-15-21(28)16-25(29)27(20,5)24(22)13-14-26(19,23)4/h8,11,17,20-21,23-25,28-29H,3,6-7,9-10,12-16H2,1-2,4-5H3/b19-8+/t20-,21+,23-,24-,25+,26+,27-/m0/s1 |
| InChIKey | LECKCPJQDIJGJF-AIDDBTOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptosporiopsis (ncbitaxon:108533) | - | DOI (10.1016/0040-4039(95)01598-1) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Abscisterol E (CHEBI:213221) has role androgen (CHEBI:50113) |
| Abscisterol E (CHEBI:213221) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (1R,3R,5S,9S,10S,13S,14S,17E)-10,13-dimethyl-17-(5-methyl-4-methylidenehexylidene)-1,2,3,4,5,6,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 78438028 | ChemSpider |