EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H49N3O5S |
| Net Charge | 0 |
| Average Mass | 587.827 |
| Monoisotopic Mass | 587.33929 |
| SMILES | COC(C)CC1C/C(C)=C/C=C/CC(C)/C=C(\C)C(=O)N2CCC[C@H]2C2=N[C@H](CS2)C(=O)N(C)[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C32H49N3O5S/c1-20(2)28-32(38)40-25(18-24(6)39-8)17-22(4)13-10-9-12-21(3)16-23(5)30(36)35-15-11-14-27(35)29-33-26(19-41-29)31(37)34(28)7/h9-10,13,16,20-21,24-28H,11-12,14-15,17-19H2,1-8H3/b10-9+,22-13+,23-16+/t21?,24?,25?,26-,27+,28+/m1/s1 |
| InChIKey | NCUIESRBHFXRKK-LLEBMXSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moorena bouillonii (ncbitaxon:207920) | - | PubMed (19754100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alotamide A (CHEBI:213213) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (2S,8E,12E,14E,20S,23S)-17-(2-methoxypropyl)-8,10,15,21-tetramethyl-20-propan-2-yl-18-oxa-25-thia-6,21,26-triazatricyclo[21.2.1.02,6]hexacosa-1(26),8,12,14-tetraene-7,19,22-trione |
| Manual Xrefs | Databases |
|---|---|
| 27024257 | ChemSpider |