EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | C[C@@H]1C[C@@](C)(O)C[C@@H]2C=C[C@H](C)[C@](O)(C=CC=CC(=O)O)[C@@H]12 |
| InChI | InChI=1S/C18H26O4/c1-12-10-17(3,21)11-14-8-7-13(2)18(22,16(12)14)9-5-4-6-15(19)20/h4-9,12-14,16,21-22H,10-11H2,1-3H3,(H,19,20)/t12-,13+,14+,16+,17-,18-/m1/s1 |
| InChIKey | WLEJNMDXTCOJFJ-RMWQOVRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (29329204) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid V (CHEBI:213181) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-[(1R,2S,4aR,6R,8R,8aS)-1,6-dihydroxy-2,6,8-trimethyl-2,4a,5,7,8,8a-hexahydronaphthalen-1-yl]penta-2,4-dienoic acid |