EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O4 |
| Net Charge | 0 |
| Average Mass | 320.429 |
| Monoisotopic Mass | 320.19876 |
| SMILES | CO[C@@H]1C=C(C)[C@H](C=CC=CC(=O)O)[C@@H]2[C@@H]1C[C@@H](CO)C[C@H]2C |
| InChI | InChI=1S/C19H28O4/c1-12-9-17(23-3)16-10-14(11-20)8-13(2)19(16)15(12)6-4-5-7-18(21)22/h4-7,9,13-17,19-20H,8,10-11H2,1-3H3,(H,21,22)/t13-,14+,15+,16-,17-,19-/m1/s1 |
| InChIKey | MOMGJYZDUGOHCM-RFRLJHHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (29329204) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid S (CHEBI:213161) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-[(1R,4S,4aS,6S,8R,8aR)-6-(hydroxymethyl)-4-methoxy-2,8-dimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]penta-2,4-dienoic acid |