EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44N4O10 |
| Net Charge | 0 |
| Average Mass | 656.733 |
| Monoisotopic Mass | 656.30574 |
| SMILES | CCCC(=O)N[C@@H](CCCCN)C(=O)O[C@@H]1C[C@H](CC=CNC(=O)C=CC=NOC)OC(=O)c2c(O)cccc2C=C[C@H](O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C33H44N4O10/c1-3-9-28(41)37-23(12-4-5-17-34)32(42)46-26-20-22(11-7-18-35-27(40)14-8-19-36-44-2)45-33(43)29-21(10-6-13-24(29)38)15-16-25(39)30-31(26)47-30/h6-8,10,13-16,18-19,22-23,25-26,30-31,38-39H,3-5,9,11-12,17,20,34H2,1-2H3,(H,35,40)(H,37,41)/t22-,23-,25-,26+,30-,31+/m0/s1 |
| InChIKey | AUAUQABOROTJFK-TUXWIUFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia (ncbitaxon:32008) | - | PubMed (32040253) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Necroxime B (CHEBI:213151) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(4S,5S,7R,8R,10S)-4,14-dihydroxy-10-[3-(4-methoxyiminobut-2-enoylamino)prop-2-enyl]-12-oxo-6,11-dioxatricyclo[11.4.0.05,7]heptadeca-1(13),2,14,16-tetraen-8-yl] (2S)-6-amino-2-(butanoylamino)hexanoate |