EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H78O2 |
| Net Charge | 0 |
| Average Mass | 747.205 |
| Monoisotopic Mass | 746.60018 |
| SMILES | CC1=C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCCC(C)C)C(=O)c2ccc(C)c(C)c2C1=O |
| InChI | InChI=1S/C53H78O2/c1-38(2)20-13-21-39(3)22-14-23-40(4)24-15-25-41(5)26-16-27-42(6)28-17-29-43(7)30-18-31-44(8)32-19-33-45(9)34-36-49-48(12)52(54)51-47(11)46(10)35-37-50(51)53(49)55/h22,24,26,28,30,32,34-35,37-38H,13-21,23,25,27,29,31,33,36H2,1-12H3/b39-22+,40-24+,41-26+,42-28+,43-30+,44-32+,45-34+ |
| InChIKey | IDYUGMBNBDIUCX-DEHWFTTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Natronobacterium gregoryi (ncbitaxon:44930) | - | DOI (10.1016/0378-1097(87)90417-4) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dimethylmenaquinone DMMK-8(VIII-H2) (CHEBI:213116) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| 3,5,6-trimethyl-2-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26-heptaenyl]naphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78436124 | ChemSpider |