EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O5 |
| Net Charge | 0 |
| Average Mass | 363.414 |
| Monoisotopic Mass | 363.17942 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](NC(=O)c2cccc(O)c2O)CCCNC1=O |
| InChI | InChI=1S/C18H25N3O5/c1-10(2)9-13-17(25)19-8-4-6-12(18(26)21-13)20-16(24)11-5-3-7-14(22)15(11)23/h3,5,7,10,12-13,22-23H,4,6,8-9H2,1-2H3,(H,19,25)(H,20,24)(H,21,26)/t12-,13+/m1/s1 |
| InChIKey | HFAZSJAUKYTBFH-OLZOCXBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SBT348 (ncbitaxon:1580538) | - | PubMed (29211005) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Petrocidin A (CHEBI:213107) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-N-[(3S,6R)-3-(2-methylpropyl)-2,5-dioxo-1,4-diazonan-6-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 63002545 | ChemSpider |