EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | COC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-11-5(8)3-2-4(7)6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1 |
| InChIKey | ZGEYCCHDTIDZAE-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glutamic acid 5-methyl ester (CHEBI:21306) is a L-glutamic acid derivative (CHEBI:83982) |
| L-glutamic acid 5-methyl ester (CHEBI:21306) is a glutamic acid 5-methyl ester (CHEBI:193556) |
| L-glutamic acid 5-methyl ester (CHEBI:21306) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-methoxy-5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-5-methoxy-5-oxo-pentanoic acid | ChEBI |
| (2S)-2-azanyl-5-methoxy-5-oxo-pentanoic acid | PDBeChem |
| 5-O-methyl-L-glutamic acid | ChEBI |
| 5-methyl L-glutamate | ChEBI |
| H-Glu(OMe)-OH | ChEBI |
| (S)-2-aminopentanedioic acid 5-methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 61916 | ChemSpider |
| GME | PDBeChem |
| HMDB0061715 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:466824 | Reaxys |
| CAS:1499-55-4 | ChemIDplus |
| Citations |
|---|