EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35N5O5 |
| Net Charge | 0 |
| Average Mass | 521.618 |
| Monoisotopic Mass | 521.26382 |
| SMILES | CC(C)C[C@H]1C(=O)N[C@@H](C)[C@]2(O)O[C@@](C)(NC(=O)[C@@H]3C=C4c5cccc6ncc(c56)C[C@H]4N(C)C3)C(=O)N12 |
| InChI | InChI=1S/C28H35N5O5/c1-14(2)9-22-25(35)30-15(3)28(37)33(22)26(36)27(4,38-28)31-24(34)17-10-19-18-7-6-8-20-23(18)16(12-29-20)11-21(19)32(5)13-17/h6-8,10,12,14-15,17,21-22,29,37H,9,11,13H2,1-5H3,(H,30,35)(H,31,34)/t15-,17+,21+,22-,27+,28-/m0/s1 |
| InChIKey | JUCIBGILHVUKSN-NLTYGUFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Balansia obtecta (ncbitaxon:40611) | - | DOI (10.1021/np50071a021) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ergobalansine (CHEBI:213059) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (6aR,9R)-N-[(2R,5S,8S,8aS)-8a-hydroxy-2,8-dimethyl-5-(2-methylpropyl)-3,6-dioxo-7,8-dihydro-5H-[1,3]oxazolo[3,2-a]pyrazin-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-g]quinoline-9-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 58828627 | ChemSpider |