EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25Cl4N3O2S |
| Net Charge | 0 |
| Average Mass | 489.296 |
| Monoisotopic Mass | 487.04216 |
| SMILES | CC(CC(=O)NC(CC(C)C(Cl)Cl)C(=O)N1CCCC1c1nccs1)C(Cl)Cl |
| InChI | InChI=1S/C18H25Cl4N3O2S/c1-10(15(19)20)8-12(24-14(26)9-11(2)16(21)22)18(27)25-6-3-4-13(25)17-23-5-7-28-17/h5,7,10-13,15-16H,3-4,6,8-9H2,1-2H3,(H,24,26) |
| InChIKey | XBWIEMGIJNHGIK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dysideaproline C (CHEBI:213054) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 4,4-dichloro-N-[5,5-dichloro-4-methyl-1-oxo-1-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]pentan-2-yl]-3-methylbutanamide |
| Manual Xrefs | Databases |
|---|---|
| 9148201 | ChemSpider |