EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3 |
| Net Charge | 0 |
| Average Mass | 207.229 |
| Monoisotopic Mass | 207.08954 |
| SMILES | CC(=O)[C@@H](C)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C11H13NO3/c1-7(8(2)13)12-10-6-4-3-5-9(10)11(14)15/h3-7,12H,1-2H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | FCBCCKJRTMUBHB-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | DOI (10.1177/1934578x1701200310) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-(1-methyl-2-oxopropylamino)-benzoic acid (CHEBI:213046) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-[[(2R)-3-oxobutan-2-yl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 63002668 | ChemSpider |