EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H59N3O9 |
| Net Charge | 0 |
| Average Mass | 749.946 |
| Monoisotopic Mass | 749.42513 |
| SMILES | CC(C)C[C@@H]1C(=O)O[C@@H](C(C)C)C(=O)N(C)[C@H](Cc2ccccc2)C(=O)O[C@@H](C(C)C)C(=O)N(C)[C@H](Cc2ccccc2)C(=O)O[C@@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C42H59N3O9/c1-25(2)22-31-40(49)52-35(27(5)6)38(47)44(10)33(24-30-20-16-13-17-21-30)42(51)54-36(28(7)8)39(48)45(11)32(23-29-18-14-12-15-19-29)41(50)53-34(26(3)4)37(46)43(31)9/h12-21,25-28,31-36H,22-24H2,1-11H3/t31-,32-,33-,34+,35+,36+/m1/s1 |
| InChIKey | VMWJARAMMKGYIN-KKNHVHQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies (ncbitaxon:29916) | - | DOI (10.1177/1934578x1601101213) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beauvericin K (CHEBI:213040) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6S,9R,12S,15R,18S)-3,9-dibenzyl-4,10,16-trimethyl-15-(2-methylpropyl)-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| Manual Xrefs | Databases |
|---|---|
| 60596838 | ChemSpider |