EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O3 |
| Net Charge | 0 |
| Average Mass | 208.217 |
| Monoisotopic Mass | 208.08479 |
| SMILES | C[C@@H](O)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C10H12N2O3/c1-6(13)10(15)12-8-5-3-2-4-7(8)9(11)14/h2-6,13H,1H3,(H2,11,14)(H,12,15)/t6-/m1/s1 |
| InChIKey | GDRIDNGVFSNDEM-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsisspecies G057 (ncbitaxon:1747356) | - | DOI (10.1177/1934578x1601100320) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[(2R)-2-hydroxypropanoyl]amino]benzamide (CHEBI:213035) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-[[(2R)-2-hydroxypropanoyl]amino]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 58197016 | ChemSpider |