EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O3 |
| Net Charge | 0 |
| Average Mass | 382.504 |
| Monoisotopic Mass | 382.22564 |
| SMILES | C/C=C/C=C(/C)C(=O)N[C@H](COC(=O)Cc1cnc2ccccc12)CC(C)C |
| InChI | InChI=1S/C23H30N2O3/c1-5-6-9-17(4)23(27)25-19(12-16(2)3)15-28-22(26)13-18-14-24-21-11-8-7-10-20(18)21/h5-11,14,16,19,24H,12-13,15H2,1-4H3,(H,25,27)/b6-5+,17-9-/t19-/m0/s1 |
| InChIKey | XAFLMOKLZWDATP-XQMNPTEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dichotomomyces (ncbitaxon:255780) | - | PubMed (29104243) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dichotomocej D (CHEBI:213030) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| [(2S)-4-methyl-2-[[(2Z,4E)-2-methylhexa-2,4-dienoyl]amino]pentyl] 2-(1H-indol-3-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 62816284 | ChemSpider |