EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | [H]C(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO3/c6-4(5(8)9)2-1-3-7/h3-4H,1-2,6H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | KABXUUFDPUOJMW-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glutamic 5-semialdehyde (CHEBI:17232) has role Escherichia coli metabolite (CHEBI:76971) |
| L-glutamic 5-semialdehyde (CHEBI:17232) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-glutamic 5-semialdehyde (CHEBI:17232) has role human metabolite (CHEBI:77746) |
| L-glutamic 5-semialdehyde (CHEBI:17232) has role mouse metabolite (CHEBI:75771) |
| L-glutamic 5-semialdehyde (CHEBI:17232) is a glutamic semialdehyde (CHEBI:24313) |
| L-glutamic 5-semialdehyde (CHEBI:17232) is tautomer of L-glutamic 5-semialdehyde zwitterion (CHEBI:58066) |
| Incoming Relation(s) |
| N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) has functional parent L-glutamic 5-semialdehyde (CHEBI:17232) |
| L-4-hydroxyglutamic semialdehyde (CHEBI:27809) has functional parent L-glutamic 5-semialdehyde (CHEBI:17232) |
| 2-acetamido-5-oxopentanoic acid (CHEBI:16319) has functional parent L-glutamic 5-semialdehyde (CHEBI:17232) |
| L-glutamic 5-semialdehyde residue (CHEBI:41433) is substituent group from L-glutamic 5-semialdehyde (CHEBI:17232) |
| L-glutamic 5-semialdehyde zwitterion (CHEBI:58066) is tautomer of L-glutamic 5-semialdehyde (CHEBI:17232) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 5-oxo-L-norvaline | ChEBI |
| L-Glutamate 5-semialdehyde | KEGG COMPOUND |
| L-Glutamate gamma-semialdehyde | KEGG COMPOUND |