EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O2S |
| Net Charge | 0 |
| Average Mass | 260.318 |
| Monoisotopic Mass | 260.06195 |
| SMILES | CS[C@H]1C(=O)n2c(cc3ccccc32)C(=O)N1C |
| InChI | InChI=1S/C13H12N2O2S/c1-14-11(16)10-7-8-5-3-4-6-9(8)15(10)12(17)13(14)18-2/h3-7,13H,1-2H3/t13-/m0/s1 |
| InChIKey | HQMUBDUTWWNNQO-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dichotomomyces (ncbitaxon:255780) | - | PubMed (29104243) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dichocerazine A (CHEBI:213007) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-methyl-3-methylsulanyl-3H-pyrazino[1,2-a]indole-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 62816286 | ChemSpider |