EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | C[C@H]1OC(=O)c2c(O)ccc(O)c2[C@@H]1O |
| InChI | InChI=1S/C10H10O5/c1-4-9(13)7-5(11)2-3-6(12)8(7)10(14)15-4/h2-4,9,11-13H,1H3/t4-,9-/m1/s1 |
| InChIKey | UKOUEEGEHXWHHO-ALFREKQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | DOI (10.1007/s10600-011-9820-9) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4S)-3,4-dihydro-4,5,8-trihydroxy-3-methylisocoumarin (CHEBI:212967) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R,4S)-4,5,8-trihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 28185028 | ChemSpider |