EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N4O4 |
| Net Charge | 0 |
| Average Mass | 414.506 |
| Monoisotopic Mass | 414.22671 |
| SMILES | CC(C)C[C@@H](N)C(=O)N[C@@H]1C[C@@]2(O)c3ccccc3N3C(=O)[C@@H](C(C)C)N(C1=O)[C@H]32 |
| InChI | InChI=1S/C22H30N4O4/c1-11(2)9-14(23)18(27)24-15-10-22(30)13-7-5-6-8-16(13)25-20(29)17(12(3)4)26(19(15)28)21(22)25/h5-8,11-12,14-15,17,21,30H,9-10,23H2,1-4H3,(H,24,27)/t14-,15-,17-,21+,22-/m1/s1 |
| InChIKey | OEDQCARJTUKFNQ-SJCPIUOGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies (ncbitaxon:5065) | - | DOI (10.1177/1934578x1501000812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperginine (CHEBI:212949) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (2R)-2-amino-N-[(1R,10R,13R,15R)-1-hydroxy-9,12-dioxo-10-propan-2-yl-8,11-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-2,4,6-trien-13-yl]-4-methylpentanamide |
| Manual Xrefs | Databases |
|---|---|
| 44210780 | ChemSpider |