EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H65N5O10 |
| Net Charge | 0 |
| Average Mass | 812.018 |
| Monoisotopic Mass | 811.47314 |
| SMILES | CCCCC(C)CC(C)C(=O)N(C)C(Cc1ccc(OC)cc1)C(=O)NC(C(=O)N(C)C(C(=O)N1CC(O)CC1C(=O)N1C(=O)C=CC1C)C(C)C)C(C)OC(C)=O |
| InChI | InChI=1S/C43H65N5O10/c1-12-13-14-26(4)21-27(5)40(53)45(9)34(22-31-16-18-33(57-11)19-17-31)39(52)44-37(29(7)58-30(8)49)42(55)46(10)38(25(2)3)43(56)47-24-32(50)23-35(47)41(54)48-28(6)15-20-36(48)51/h15-20,25-29,32,34-35,37-38,50H,12-14,21-24H2,1-11H3,(H,44,52) |
| InChIKey | NKBHDXJJPQYANN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | DOI (10.1016/0031-9422(88)80008-6) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Majusculamide D (CHEBI:212938) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [3-[[2-[2,4-dimethyloctanoyl(methyl)amino]-3-(4-methoxyphenyl)propanoyl]amino]-4-[[1-[4-hydroxy-2-(2-methyl-5-oxo-2H-pyrrole-1-carbonyl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-methylamino]-4-oxobutan-2-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 10472230 | ChemSpider |