EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H65N5O9 |
| Net Charge | 0 |
| Average Mass | 796.019 |
| Monoisotopic Mass | 795.47823 |
| SMILES | CCCCC(C)CC(C)C(=O)N(C)C(Cc1ccc(OC)cc1)C(=O)NC(C(=O)N(C)C(C(=O)N1CCCC1C(=O)N1C(=O)C=CC1C)C(C)C)C(C)OC(C)=O |
| InChI | InChI=1S/C43H65N5O9/c1-12-13-15-27(4)24-28(5)40(52)45(9)35(25-32-18-20-33(56-11)21-19-32)39(51)44-37(30(7)57-31(8)49)42(54)46(10)38(26(2)3)43(55)47-23-14-16-34(47)41(53)48-29(6)17-22-36(48)50/h17-22,26-30,34-35,37-38H,12-16,23-25H2,1-11H3,(H,44,51) |
| InChIKey | BIKVQCBBPZOYLU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | DOI (10.1016/0031-9422(88)80008-6) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deoxy-Majusculamide D (CHEBI:212932) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [3-[[2-[2,4-dimethyloctanoyl(methyl)amino]-3-(4-methoxyphenyl)propanoyl]amino]-4-[methyl-[3-methyl-1-[2-(2-methyl-5-oxo-2H-pyrrole-1-carbonyl)pyrrolidin-1-yl]-1-oxobutan-2-yl]amino]-4-oxobutan-2-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 10472231 | ChemSpider |