EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O14 |
| Net Charge | 0 |
| Average Mass | 516.452 |
| Monoisotopic Mass | 516.14791 |
| SMILES | O=C(/C=C/c1ccc(O[C@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)c(O)c1)OC1[C@H](O)CC(O)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C22H28O14/c23-8-14-16(28)17(29)18(30)20(35-14)34-13-3-1-9(5-10(13)24)2-4-15(27)36-19-11(25)6-22(33,21(31)32)7-12(19)26/h1-5,11-12,14,16-20,23-26,28-30,33H,6-8H2,(H,31,32)/b4-2+/t11-,12-,14+,16+,17-,18+,19?,20+,22?/m1/s1 |
| InChIKey | WFYFOXSDFJBMRW-LRINATJCSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-4-O-(4-O-beta-D-glucopyranosylcaffeoyl)quinic acid (CHEBI:212927) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (3R,5R)-1,3,5-trihydroxy-4-[(E)-3-[3-hydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxycyclohexane-1-carboxylic acid |