EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N4O5 |
| Net Charge | 0 |
| Average Mass | 466.538 |
| Monoisotopic Mass | 466.22162 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](C)NC(=O)c2ccccc2NC(=O)[C@@H]([C@@H](O)c2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C25H30N4O5/c1-14(2)19-25(34)29(4)20(21(30)16-10-6-5-7-11-16)24(33)27-18-13-9-8-12-17(18)23(32)26-15(3)22(31)28-19/h5-15,19-21,30H,1-4H3,(H,26,32)(H,27,33)(H,28,31)/t15-,19-,20+,21-/m0/s1 |
| InChIKey | SPXHRJGWIPFICV-KQLYMOGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1177/1934578x1501000659) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperterrestride B (CHEBI:212919) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (4R,7S,10S)-4-[(S)-hydroxy(phenyl)methyl]-5,10-dimethyl-7-propan-2-yl-2,5,8,11-tetrazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,6,9,12-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 44210764 | ChemSpider |