EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | C[C@@H](O)c1ccc(C(=O)CCC(=O)O)o1 |
| InChI | InChI=1S/C10H12O5/c1-6(11)8-3-4-9(15-8)7(12)2-5-10(13)14/h3-4,6,11H,2,5H2,1H3,(H,13,14)/t6-/m1/s1 |
| InChIKey | QZPMJUUYIRZJKD-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsisspecies (ncbitaxon:1715245) | - | DOI (10.1002/ejoc.200500290) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[5-(1-hydroxyethyl)furan-2-yl]-4-oxobutanoic acid (CHEBI:212910) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 4-[5-[(1R)-1-hydroxyethyl]uran-2-yl]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 75141168 | ChemSpider |