EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O6 |
| Net Charge | 0 |
| Average Mass | 318.325 |
| Monoisotopic Mass | 318.11034 |
| SMILES | COc1cc(OC)c2c(c1)C(=O)C1=C(C2=O)[C@H](OC)O[C@@H](C)C1 |
| InChI | InChI=1S/C17H18O6/c1-8-5-10-14(17(22-4)23-8)16(19)13-11(15(10)18)6-9(20-2)7-12(13)21-3/h6-8,17H,5H2,1-4H3/t8-,17+/m0/s1 |
| InChIKey | ZUCKMONTTODKPQ-WNWIJWBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astrosphaeriella (ncbitaxon:682060) | - | PubMed (19431097) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Astropaquinone B (CHEBI:212863) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (1R,3S)-1,7,9-trimethoxy-3-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 28287847 | ChemSpider |