EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O5 |
| Net Charge | 0 |
| Average Mass | 344.407 |
| Monoisotopic Mass | 344.16237 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C(O)=C3[C@](C)(C(=O)O)CC=C[C@]3(C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C20H24O5/c1-5-17(2)9-10-20(25)12(11-17)13(21)14(22)15-18(3,16(23)24)7-6-8-19(15,20)4/h5-6,8,11,22,25H,1,7,9-10H2,2-4H3,(H,23,24)/t17-,18+,19-,20+/m0/s1 |
| InChIKey | WIEULLALQDWNTC-ZGXWSNOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Emericellopsis fimetaria (ncbitaxon:327576) | - | PubMed (28805711) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Opened gamma-lactone ring of libertellenone M (CHEBI:212855) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,4aS,4bS,7R)-7-ethenyl-4b,10-dihydroxy-1,4a,7-trimethyl-9-oxo-5,6-dihydro-2H-phenanthrene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 64186235 | ChemSpider |