EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42N6O5 |
| Net Charge | 0 |
| Average Mass | 530.670 |
| Monoisotopic Mass | 530.32167 |
| SMILES | CCCCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N1C[C@@H](C)C[C@H]1C(=O)NC(C=O)CCCN=C(N)N |
| InChI | InChI=1S/C27H42N6O5/c1-3-4-5-8-24(36)32-22(15-19-9-11-21(35)12-10-19)26(38)33-16-18(2)14-23(33)25(37)31-20(17-34)7-6-13-30-27(28)29/h9-12,17-18,20,22-23,35H,3-8,13-16H2,1-2H3,(H,31,37)(H,32,36)(H4,28,29,30)/t18-,20?,22-,23-/m0/s1 |
| InChIKey | ULFMNSXBTYDMFI-JLWWHIBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena AV1 (ncbitaxon:284707) | - | PubMed (25419633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudoaeruginosin NS1 (CHEBI:212838) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S,4S)-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(hexanoylamino)-3-(4-hydroxyphenyl)propanoyl]-4-methylpyrrolidine-2-carboxamide |