EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O3 |
| Net Charge | 0 |
| Average Mass | 386.576 |
| Monoisotopic Mass | 386.28210 |
| SMILES | C[C@H](C(=O)O)[C@H]1CC[C@@]2(C)C3=CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C25H38O3/c1-15(21(27)28)16-9-13-25(6)18-7-8-19-22(2,3)20(26)11-12-23(19,4)17(18)10-14-24(16,25)5/h7,10,15-16,19-20,26H,8-9,11-14H2,1-6H3,(H,27,28)/t15-,16+,19-,20-,23+,24+,25-/m0/s1 |
| InChIKey | UTSCVCXUBUMWOX-ICDOJPABSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Akanthomyces lecanii (ncbitaxon:2714763) | - | DOI (10.1039/p19840000497) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3beta-hydroxy-4,4,14alpha-trimethyl-5alpha-pregna-7,9(11)-diene-20S-carboxylic acid (CHEBI:212834) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2S)-2-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443448 | ChemSpider |