EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N2O2 |
| Net Charge | -1 |
| Average Mass | 145.182 |
| Monoisotopic Mass | 145.09825 |
| SMILES | C[C@H](N)C[C@H](N)CC(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c1-4(7)2-5(8)3-6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/p-1/t4-,5-/m0/s1 |
| InChIKey | NGDLSXMSQYUVSJ-WHFBIAKZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,5S)-3,5-diaminohexanoate (CHEBI:21282) has functional parent hexanoate (CHEBI:17120) |
| (3S,5S)-3,5-diaminohexanoate (CHEBI:21282) is a diamino acid anion (CHEBI:59561) |
| (3S,5S)-3,5-diaminohexanoate (CHEBI:21282) is conjugate base of (3S,5S)-3,5-diaminohexanoic acid (CHEBI:15616) |
| Incoming Relation(s) |
| (3S,5S)-3,5-diaminohexanoic acid (CHEBI:15616) is conjugate acid of (3S,5S)-3,5-diaminohexanoate (CHEBI:21282) |
| IUPAC Name |
|---|
| (3S,5S)-3,5-diaminohexanoate |
| Synonyms | Source |
|---|---|
| (3S,5S)-3,5-diaminocaproate | ChEBI |
| L-erythro-3,5-diaminocaproate | ChEBI |
| L-erythro-3,5-diaminohexanoate | ChEBI |