EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H30O7 |
| Net Charge | 0 |
| Average Mass | 502.563 |
| Monoisotopic Mass | 502.19915 |
| SMILES | C=C(C)[C@@H]1Cc2cc(OC/C=C(\C)CO)c(OC)cc2C2=C1C(=O)C(c1ccc(O)cc1)=C(OC)C2=O |
| InChI | InChI=1S/C30H30O7/c1-16(2)21-12-19-13-24(37-11-10-17(3)15-31)23(35-4)14-22(19)27-26(21)28(33)25(30(36-5)29(27)34)18-6-8-20(32)9-7-18/h6-10,13-14,21,31-32H,1,11-12,15H2,2-5H3/b17-10+/t21-/m0/s1 |
| InChIKey | VWRLNCDUUPLPME-KRWRZEAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus peyronelii (ncbitaxon:176177) | - | PubMed (9599285) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arenatin C (CHEBI:212794) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 7-[(E)-4-hydroxy-3-methylbut-2-enoxy]-2-(4-hydroxyphenyl)-3,6-dimethoxy-10-prop-1-en-2-yl-9,10-dihydrophenanthrene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 8824475 | ChemSpider |