EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N4O8 |
| Net Charge | 0 |
| Average Mass | 538.642 |
| Monoisotopic Mass | 538.30026 |
| SMILES | C=C1C[C@](OC)([C@H](O)C(=O)N/C=C/C(C)[C@@H](O)C(C)C(=O)N2CCC[C@H]2C(=O)NCC(N)=O)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C26H42N4O8/c1-14(9-10-28-24(35)22(33)26(37-6)12-15(2)16(3)18(5)38-26)21(32)17(4)25(36)30-11-7-8-19(30)23(34)29-13-20(27)31/h9-10,14,16-19,21-22,32-33H,2,7-8,11-13H2,1,3-6H3,(H2,27,31)(H,28,35)(H,29,34)/b10-9+/t14?,16-,17?,18-,19+,21-,22-,26-/m1/s1 |
| InChIKey | VANNEGUZJFATRF-ZXJKYMOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cuspidothrix issatschenkoi (ncbitaxon:230752) | - | PubMed (29570981) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cusperin A (CHEBI:212789) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N-(2-amino-2-oxoethyl)-1-[(E,3R)-3-hydroxy-6-[[(2S)-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetyl]amino]-2,4-dimethylhex-5-enoyl]pyrrolidine-2-carboxamide |