EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H43N5O6 |
| Net Charge | 0 |
| Average Mass | 545.681 |
| Monoisotopic Mass | 545.32133 |
| SMILES | CCC(C)C(NC(=O)NC1CCCCNC(=O)C(CCc2ccccc2)NC(=O)C(C(C)C)NC1=O)C(=O)O |
| InChI | InChI=1S/C28H43N5O6/c1-5-18(4)23(27(37)38)33-28(39)31-20-13-9-10-16-29-24(34)21(15-14-19-11-7-6-8-12-19)30-26(36)22(17(2)3)32-25(20)35/h6-8,11-12,17-18,20-23H,5,9-10,13-16H2,1-4H3,(H,29,34)(H,30,36)(H,32,35)(H,37,38)(H2,31,33,39) |
| InChIKey | KSERJDNPRNPELX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostocspecies CENA543 (ncbitaxon:1869241) | - | PubMed (28933529) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Namalide E (CHEBI:212780) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 3-methyl-2-[[2,5,8-trioxo-3-(2-phenylethyl)-6-propan-2-yl-1,4,7-triazacyclotridec-9-yl]carbamoylamino]pentanoic acid |