EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H45N5O6 |
| Net Charge | 0 |
| Average Mass | 559.708 |
| Monoisotopic Mass | 559.33698 |
| SMILES | CCC(C)C(NC(=O)NC1CCCCNC(=O)C(CCc2ccccc2)NC(=O)C(C(C)CC)NC1=O)C(=O)O |
| InChI | InChI=1S/C29H45N5O6/c1-5-18(3)23-27(37)31-22(16-15-20-12-8-7-9-13-20)25(35)30-17-11-10-14-21(26(36)33-23)32-29(40)34-24(28(38)39)19(4)6-2/h7-9,12-13,18-19,21-24H,5-6,10-11,14-17H2,1-4H3,(H,30,35)(H,31,37)(H,33,36)(H,38,39)(H2,32,34,40) |
| InChIKey | YLSOIPHOXMRWGW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostocspecies CENA543 (ncbitaxon:1869241) | - | PubMed (28933529) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Namalide D (CHEBI:212775) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 2-[[6-butan-2-yl-2,5,8-trioxo-3-(2-phenylethyl)-1,4,7-triazacyclotridec-9-yl]carbamoylamino]-3-methylpentanoic acid |