EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35NO5 |
| Net Charge | 0 |
| Average Mass | 441.568 |
| Monoisotopic Mass | 441.25152 |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(C)Cc2c(c(O)cc3c2CN(CC(=O)O)C3=O)C[C@@H]1O |
| InChI | InChI=1S/C26H35NO5/c1-16(2)7-5-8-17(3)9-6-10-26(4)13-20-18(12-23(26)29)22(28)11-19-21(20)14-27(25(19)32)15-24(30)31/h7,9,11,23,28-29H,5-6,8,10,12-15H2,1-4H3,(H,30,31)/b17-9+/t23-,26+/m0/s1 |
| InChIKey | SBIDNDHCLLIYPY-ZDUHKQCDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachybotrys (ncbitaxon:74721) | - | PubMed (28678182) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FGFC6 (CHEBI:212765) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-[(7S,8R)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-5,7-dihydroxy-8-methyl-3-oxo-1,6,7,9-tetrahydrobenzo[e]isoindol-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439236 | ChemSpider |