EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H59N7O8 |
| Net Charge | 0 |
| Average Mass | 777.964 |
| Monoisotopic Mass | 777.44251 |
| SMILES | CCC(C)C1NC(=O)C(NC(=O)NC(C(=O)O)C(C)C)CCCCNC(=O)C(Cc2ccccc2)NC(=O)C(C)N(C)C(=O)C(CCc2ccccc2)NC1=O |
| InChI | InChI=1S/C41H59N7O8/c1-7-26(4)34-38(52)43-31(22-21-28-16-10-8-11-17-28)39(53)48(6)27(5)35(49)44-32(24-29-18-12-9-13-19-29)36(50)42-23-15-14-20-30(37(51)46-34)45-41(56)47-33(25(2)3)40(54)55/h8-13,16-19,25-27,30-34H,7,14-15,20-24H2,1-6H3,(H,42,50)(H,43,52)(H,44,49)(H,46,51)(H,54,55)(H2,45,47,56) |
| InChIKey | DPIGYJZDLCREAR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostocspecies CENA543 (ncbitaxon:1869241) | - | PubMed (28933529) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nostamide D (CHEBI:212761) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 2-[[3-benzyl-12-butan-2-yl-6,7-dimethyl-2,5,8,11,14-pentaoxo-9-(2-phenylethyl)-1,4,7,10,13-pentazacyclononadec-15-yl]carbamoylamino]-3-methylbutanoic acid |