EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | C[C@H](O)C(=O)CCC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C14H18O4/c1-11(15)13(16)7-8-14(17)18-10-9-12-5-3-2-4-6-12/h2-6,11,15H,7-10H2,1H3/t11-/m0/s1 |
| InChIKey | CBRTUJLHRMPSSF-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrinium (ncbitaxon:112177) | - | DOI (10.1007/s10600-017-1994-3) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenethyl 5-hydroxy-4-oxohexanoate (CHEBI:212721) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 2-phenylethyl 5-hydroxy-4-oxohexanoate |
| Manual Xrefs | Databases |
|---|---|
| 67172845 | ChemSpider |