EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O6 |
| Net Charge | 0 |
| Average Mass | 254.238 |
| Monoisotopic Mass | 254.07904 |
| SMILES | Cc1c(O)cc(O)c2c1[C@@](C)(O)[C@H](CO)OC2=O |
| InChI | InChI=1S/C12H14O6/c1-5-6(14)3-7(15)9-10(5)12(2,17)8(4-13)18-11(9)16/h3,8,13-15,17H,4H2,1-2H3/t8-,12-/m0/s1 |
| InChIKey | AMIBGNGDZAYRNZ-UFBFGSQYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leptosphaeria (ncbitaxon:5021) | - | PubMed (28661451) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clearanol J (CHEBI:212699) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S,4R)-4,6,8-trihydroxy-3-(hydroxymethyl)-4,5-dimethyl-3H-isochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 62233316 | ChemSpider |