EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | C[C@H]1CCC[C@H](C[C@H]2Cc3c(O)c(O)cc(O)c3C(=O)O2)O1 |
| InChI | InChI=1S/C16H20O6/c1-8-3-2-4-9(21-8)5-10-6-11-14(16(20)22-10)12(17)7-13(18)15(11)19/h7-10,17-19H,2-6H2,1H3/t8-,9+,10-/m0/s1 |
| InChIKey | VJAXQPIMLAFBFH-AEJSXWLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (28635658) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperentin B (CHEBI:212687) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-5,6,8-trihydroxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 59718424 | ChemSpider |