EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O4 |
| Net Charge | 0 |
| Average Mass | 484.721 |
| Monoisotopic Mass | 484.35526 |
| SMILES | C[C@@H]1C[C@@]2(OC(=O)[C@@H](C)[C@@H]2C)O[C@@H]2CC3=C(CC[C@H]4C(C)(C)[C@H](O)CC[C@]34C)[C@]3(C)CC[C@H]1[C@@]23C |
| InChI | InChI=1S/C31H48O4/c1-17-16-31(19(3)18(2)26(33)35-31)34-25-15-22-21(29(7)14-11-20(17)30(25,29)8)9-10-23-27(4,5)24(32)12-13-28(22,23)6/h17-20,23-25,32H,9-16H2,1-8H3/t17-,18+,19+,20-,23+,24-,25-,28-,29+,30+,31+/m1/s1 |
| InChIKey | LSGLUPXTGXDHCT-ZBAFWHTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodofomes cajanderi (ncbitaxon:2066993) | - | PubMed (14510609) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fomlactone B (CHEBI:212674) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1S,3'S,4'S,5R,7R,10S,13R,15S,17R,18R,21R)-7-hydroxy-1,3',4',6,6,10,17,21-octamethylspiro[14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicos-2(11)-ene-15,5'-oxolane]-2'-one |
| Manual Xrefs | Databases |
|---|---|
| 10001646 | ChemSpider |