EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N4O2 |
| Net Charge | 0 |
| Average Mass | 448.611 |
| Monoisotopic Mass | 448.28383 |
| SMILES | CN[C@@H](CC(C)C)C(=O)N(C)[C@@H](Cc1ccccc1)C(=O)NCCc1cnc2ccccc12 |
| InChI | InChI=1S/C27H36N4O2/c1-19(2)16-24(28-3)27(33)31(4)25(17-20-10-6-5-7-11-20)26(32)29-15-14-21-18-30-23-13-9-8-12-22(21)23/h5-13,18-19,24-25,28,30H,14-17H2,1-4H3,(H,29,32)/t24-,25-/m0/s1 |
| InChIKey | SOIIKURIVIWMKK-DQEYMECFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (18491867) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xenortide B (CHEBI:212671) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1-oxo-3-phenylpropan-2-yl]-N,4-dimethyl-2-(methylamino)pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 24701785 | ChemSpider |