EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O3 |
| Net Charge | 0 |
| Average Mass | 222.244 |
| Monoisotopic Mass | 222.10044 |
| SMILES | CC(C)C(=O)Nc1c(O)cccc1C(N)=O |
| InChI | InChI=1S/C11H14N2O3/c1-6(2)11(16)13-9-7(10(12)15)4-3-5-8(9)14/h3-6,14H,1-2H3,(H2,12,15)(H,13,16) |
| InChIKey | QLFWPFJWFDNGQP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (21467672) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2-N-iso-butyryl-anthranilamide (CHEBI:212664) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 3-hydroxy-2-(2-methylpropanoylamino)benzamide |
| Manual Xrefs | Databases |
|---|---|
| 28185105 | ChemSpider |