EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54N4O7 |
| Net Charge | 0 |
| Average Mass | 606.805 |
| Monoisotopic Mass | 606.39925 |
| SMILES | COC1=CC(=O)N(C(=O)[C@H]2CCCN2C(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](OC(=O)[C@H](CC(C)C)N(C)C)C(C)C)[C@@H]1C(C)C |
| InChI | InChI=1S/C32H54N4O7/c1-18(2)16-23(33(9)10)32(41)43-28(21(7)8)31(40)34(11)27(20(5)6)30(39)35-15-13-14-22(35)29(38)36-25(37)17-24(42-12)26(36)19(3)4/h17-23,26-28H,13-16H2,1-12H3/t22-,23+,26-,27+,28+/m1/s1 |
| InChIKey | YOTGKFHYVQWTJS-OZGQDTGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scytonema (ncbitaxon:1203) | - | DOI (10.1016/s0040-4020(01)96119-8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mirabimide C (CHEBI:212655) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| [(2S)-1-[[(2S)-1-[(2R)-2-[(2R)-3-methoxy-5-oxo-2-propan-2-yl-2H-pyrrole-1-carbonyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl] (2S)-2-(dimethylamino)-4-methylpentanoate |