EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31ClO5 |
| Net Charge | 0 |
| Average Mass | 446.971 |
| Monoisotopic Mass | 446.18600 |
| SMILES | C/C=C/CC/C(C)=C/C[C@]1(O)C(=O)c2cc(O)c(C)c(O)c2C(=O)[C@@]1(Cl)CC=C(C)C |
| InChI | InChI=1S/C25H31ClO5/c1-6-7-8-9-16(4)11-13-25(31)22(29)18-14-19(27)17(5)21(28)20(18)23(30)24(25,26)12-10-15(2)3/h6-7,10-11,14,27-28,31H,8-9,12-13H2,1-5H3/b7-6+,16-11+/t24-,25-/m0/s1 |
| InChIKey | JGMYKQSJCKJGOP-YZBGCZFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3610830) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SF2415B1 (CHEBI:212648) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| (2S,3R)-3-chloro-2,5,7-trihydroxy-6-methyl-3-(3-methylbut-2-enyl)-2-[(2E,6E)-3-methylocta-2,6-dienyl]naphthalene-1,4-dione |