EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:212641 - Mirabimide A
| Formula | C33H56N4O7 |
| Net Charge | 0 |
| Average Mass | 620.832 |
| Monoisotopic Mass | 620.41490 |
| SMILES | CC[C@H](C)[C@H](OC(=O)[C@H](CC(C)C)N(C)C)C(=O)N(C)[C@H](C(=O)N1CCC[C@@H]1C(=O)N1C(=O)C=C(OC)[C@H]1C(C)C)C(C)C |
| InChI | InChI=1S/C33H56N4O7/c1-13-22(8)29(44-33(42)24(34(9)10)17-19(2)3)32(41)35(11)28(21(6)7)31(40)36-16-14-15-23(36)30(39)37-26(38)18-25(43-12)27(37)20(4)5/h18-24,27-29H,13-17H2,1-12H3/t22-,23+,24-,27+,28-,29-/m0/s1 |
| InChIKey | HWFRVWXLBKHDOI-RKMTVKOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scytonema (ncbitaxon:1203) | - | DOI (10.1016/s0040-4020(01)96119-8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mirabimide A (CHEBI:212641) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| [(2S,3S)-1-[[(2S)-1-[(2R)-2-[(2R)-3-methoxy-5-oxo-2-propan-2-yl-2H-pyrrole-1-carbonyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxopentan-2-yl] (2S)-2-(dimethylamino)-4-methylpentanoate |