EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO4 |
| Net Charge | 0 |
| Average Mass | 297.395 |
| Monoisotopic Mass | 297.19401 |
| SMILES | CCCCCCC(C)/C(O)=C1\C(=O)[C@H](C(C)O)N(C)C1=O |
| InChI | InChI=1S/C16H27NO4/c1-5-6-7-8-9-10(2)14(19)12-15(20)13(11(3)18)17(4)16(12)21/h10-11,13,18-19H,5-9H2,1-4H3/b14-12-/t10?,11?,13-/m0/s1 |
| InChIKey | KWUIFAHSOVLDLQ-QZDCTXLUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (18239314) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicillenol A1 (CHEBI:212639) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| (3Z,5S)-5-(1-hydroxyethyl)-3-(1-hydroxy-2-methyloctylidene)-1-methylpyrrolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 27023247 | ChemSpider |