EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H43ClN6O6 |
| Net Charge | 0 |
| Average Mass | 607.152 |
| Monoisotopic Mass | 606.29326 |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](O)Cc1ccc(O)c(Cl)c1)C(=O)N1[C@H](C(=O)NC2CCCN2C(=N)N)C[C@@H]2CC[C@@H](O)C[C@@H]21 |
| InChI | InChI=1S/C29H43ClN6O6/c1-15(2)10-20(33-27(41)24(39)12-16-5-8-23(38)19(30)11-16)28(42)36-21-14-18(37)7-6-17(21)13-22(36)26(40)34-25-4-3-9-35(25)29(31)32/h5,8,11,15,17-18,20-22,24-25,37-39H,3-4,6-7,9-10,12-14H2,1-2H3,(H3,31,32)(H,33,41)(H,34,40)/t17-,18+,20+,21-,22-,24+,25?/m0/s1 |
| InChIKey | VTKSRNODZPGCEU-ZNLUQXHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | DOI (10.1016/j.tet.2014.07.057) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosin LH606 (CHEBI:212496) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3aS,6R,7aS)-N-(1-carbamimidoylpyrrolidin-2-yl)-1-[(2R)-2-[[(2R)-3-(3-chloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-4-methylpentanoyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |