EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44N2O10S2 |
| Net Charge | 0 |
| Average Mass | 704.864 |
| Monoisotopic Mass | 704.24374 |
| SMILES | CCCCC[C@H](O)CC(=O)O[C@H]1C=COC=C2C[C@@]34SS[C@]5(CC6=COC=C[C@H](OC(=O)C[C@@H](O)CCCCC)[C@H]6N5C3=O)C(=O)N4[C@@H]21 |
| InChI | InChI=1S/C34H44N2O10S2/c1-3-5-7-9-23(37)15-27(39)45-25-11-13-43-19-21-17-33-32(42)36-30-22(18-34(36,48-47-33)31(41)35(33)29(21)25)20-44-14-12-26(30)46-28(40)16-24(38)10-8-6-4-2/h11-14,19-20,23-26,29-30,37-38H,3-10,15-18H2,1-2H3/t23-,24-,25-,26-,29-,30-,33+,34+/m0/s1 |
| InChIKey | KSMQCJNGMSYVJZ-SJQRTZAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphium (ncbitaxon:76204) | - | PubMed (25899125) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Graphiumin A (CHEBI:212490) is a 2,5-diketopiperazines (CHEBI:65061) |
| Graphiumin A (CHEBI:212490) is a indoles (CHEBI:24828) |
| Graphiumin A (CHEBI:212490) is a organic disulfide (CHEBI:35489) |
| Graphiumin A (CHEBI:212490) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| [(1R,4S,5S,12R,15S,16S)-16-[(3S)-3-hydroxyoctanoyl]oxy-2,13-dioxo-8,19-dioxa-23,24-dithia-3,14-diazahexacyclo[10.10.2.01,14.03,12.04,10.015,21]tetracosa-6,9,17,20-tetraen-5-yl] (3S)-3-hydroxyoctanoate |
| Manual Xrefs | Databases |
|---|---|
| 40256642 | ChemSpider |