EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C61H92O2 |
| Net Charge | 0 |
| Average Mass | 857.405 |
| Monoisotopic Mass | 856.70973 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(C)CCCC(C)CCC/C(C)=C/CC1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C61H92O2/c1-46(2)24-15-25-47(3)26-16-27-48(4)28-17-29-49(5)30-18-31-50(6)32-19-33-51(7)34-20-35-52(8)36-21-37-53(9)38-22-39-54(10)40-23-41-55(11)44-45-57-56(12)60(62)58-42-13-14-43-59(58)61(57)63/h13-14,24,26,28,30,32,34,36,42-44,53-54H,15-23,25,27,29,31,33,35,37-41,45H2,1-12H3/b47-26+,48-28+,49-30+,50-32+,51-34+,52-36+,55-44+ |
| InChIKey | ZLDOXQQBKCBYHC-UDEVRPQKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycomyces rutgersensis (ncbitaxon:58115) | - | DOI (10.1111/j.1574-6968.1987.tb02270.x) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Menaquinone-10 (II-, III-H4) (CHEBI:212483) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| 2-[(2E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,14,18,22,26,30,34,38-octaenyl]-3-methylnaphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78435502 | ChemSpider |