EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N6O4 |
| Net Charge | 0 |
| Average Mass | 298.303 |
| Monoisotopic Mass | 298.13895 |
| SMILES | CC(=O)OC[C@@H]1N=C(N)N2CCC(O)(O)[C@@]23NC(N)=N[C@@H]13 |
| InChI | InChI=1S/C11H18N6O4/c1-5(18)21-4-6-7-11(16-8(12)15-7)10(19,20)2-3-17(11)9(13)14-6/h6-7,19-20H,2-4H2,1H3,(H2,13,14)(H3,12,15,16)/t6-,7-,11-/m0/s1 |
| InChIKey | FYMGGEYPNDYSSU-HFJPGXAFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microseira wollei (ncbitaxon:467598) | - | PubMed (9407557) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl acetate (CHEBI:212458) has role marine metabolite (CHEBI:76507) |
| [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl acetate (CHEBI:212458) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl acetate |
| Manual Xrefs | Databases |
|---|---|
| 128444593 | ChemSpider |